Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 2-fluoroacetamide |
IUPAC name: | 2-fluoroacetamide |
CAS name: | 2-fluoroacetamide |
CAS Reg. No.: | 640-19-7 |
Formula: | C2H4FNO |
Activity: | rodenticides (halogenated alkanoic acid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | floo-a-rō-a-sēt-a-mīd Guide to British pronunciation |
InChIKey: | FVTWJXMFYOXOKK-UHFFFAOYSA-N |
InChI: | InChI=1S/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5) |
A data sheet from the Compendium of Pesticide Common Names