| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-fluoroethyl biphenyl-4-ylacetate |
| CAS: | 2-fluoroethyl [1,1′-biphenyl]-4-acetate |
| Reg. No.: | 4301-50-2 |
| Formula: | C16H15FO2 |
| Activity: | acaricides (unclassified acaricides) |
| Notes: | * According to ISO 1750, the name “fluénéthyl” is used in France, but the ISO common name “fluénétil” also appears to be used. |
| Structure: | ![]() |
| Pronunciation: | floo-ēn-ě-tīl Guide to British pronunciation |
| InChIKey: | XAERLJMOUYEBAB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H15FO2/c17-10-11-19-16(18)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9H,10-12H2 |
A data sheet from the Compendium of Pesticide Common Names