| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3′,4′-dichloro-1,2,3,4-tetrahydro-6-hydroxy-1,3-dimethyl-2,4-dioxopyrimidine-5-carboxanilide |
| CAS: | N-(3,4-dichlorophenyl)hexahydro-1,3-dimethyl-2,4,6-trioxo-5-pyrimidinecarboxamide |
| Reg. No.: | 65400-98-8 |
| Formula: | C13H11Cl2N3O4 |
| Activity: | insecticides (unclassified insecticides) |
| Notes: | The IUPAC name and the structural formula correspond to the information provided by the manufacturer. The CAS name and Registry Number are for the tautomer that is preferred under the CAS nomenclature rules. |
| Structure: |  |
| Pronunciation: | fěn-ǒks-a-krǐm Guide to British pronunciation |
| InChI: | InChI=1/C13H11Cl2N3O4/c1-17-11(20)9(12(21)18(2)13(17)22)10(19)16-6-3-4-7(14)8(15)5-6/h3-5,20H,1-2H3,(H,16,19)/f/h16H CAS-preferred tautomer: InChI=1/C13H11Cl2N3O4/c1-17-11(20)9(12(21)18(2)13(17)22)10(19)16-6-3-4-7(14)8(15)5-6/h3-5,9H,1-2H3,(H,16,19)/f/h16H |