Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-2-[(2R)-butan-2-yl]phenyl methylcarbamate |
IUPAC name: | 2-[(1RS)-1-methylpropyl]phenyl methylcarbamate 1979 Rules: (RS)-2-sec-butylphenyl methylcarbamate |
CAS name: | 2-(1-methylpropyl)phenyl N-methylcarbamate |
CAS Reg. No.: | 3766-81-2 |
Formula: | C12H17NO2 |
Activity: | insecticides (phenyl carbamate) |
Notes: | The name “BPMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | fěn-ō-bū-karb Guide to British pronunciation |
InChIKey: | DIRFUJHNVNOBMY-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H17NO2/c1-4-9(2)10-7-5-6-8-11(10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names