Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 3,5-diethylphenyl methylcarbamate |
IUPAC name: | 3,5-diethylphenyl methylcarbamate |
CAS name: | 3,5-diethylphenyl N-methylcarbamate |
CAS Reg. No.: | 30087-47-9 |
Formula: | C12H17NO2 |
Activity: | insecticides (phenyl carbamate) |
Notes: | * The name “fénétacarbe” (n.m.) is also used in francophone countries. |
Structure: | |
Pronunciation: | fěn-ěth-a-karb Guide to British pronunciation |
InChIKey: | HUNDISMVCBSIKO-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H17NO2/c1-4-9-6-10(5-2)8-11(7-9)15-12(14)13-3/h6-8H,4-5H2,1-3H3,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names