| Status: | WSSA |
|---|---|
| IUPAC: | O,O-diethyl dithiobis(thioformate) |
| CAS: | thioperoxydicarbonic acid ([(HO)C(S)]2S2) diethyl ester |
| Reg. No.: | 502-55-6 |
| Formula: | C6H10O2S4 |
| Activity: | herbicides (thiocarbonate herbicides) insecticides (unclassified insecticides) |
| Notes: | There is no ISO common name for this substance; the name “EXD” is approved by the Weed Science Society of America and the name “dixanthogen” is approved by the World Health Organization. The analogous dimethyl ester has the WSSA common name dimexano. |
| Structure: |  |
| Pronunciation: | ē ěks dē Guide to British pronunciation |
| InChIKey: | FVIGODVHAVLZOO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H10O2S4/c1-3-7-5(9)11-12-6(10)8-4-2/h3-4H2,1-2H3 |