| Status: | ISO 765 |
|---|---|
| IUPAC: | ethylmercury(II) acetate or ethylmercury(2+) acetate or ethylmercuric acetate |
| CAS: | (acetato-κO)ethylmercury |
| Reg. No.: | 109-62-6 |
| Formula: | C4H8HgO2 |
| Activity: | fungicides (organomercury fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | ē-thīl-mer-kūr-ē ǎs-ǐ-tāt Guide to British pronunciation |
| InChI: | InChI=1/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1/fC2H3O2.C2H5.Hg/q-1;;m/rC4H8HgO2/c1-3-5-7-4(2)6/h3H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names