| Status: |
none |
| IUPAC: |
1,1-dichloro-2,2-bis(4-ethylphenyl)ethane |
| CAS: |
1,1′-(2,2-dichloroethylidene)bis[4-ethylbenzene] |
| Reg. No.: |
72-56-0 |
| Formula: |
C18H20Cl2 |
| Activity: |
insecticides (organochlorine insecticides) |
| Notes: |
There is no ISO common name for this substance; the names “ethyl-DDD” and “ethylan” have been used in the literature but have no official status. |
| Structure: |
 |
| Pronunciation: |
ē-thīl dē dē dē Guide to British pronunciation |
| InChI: |
InChI=1/C18H20Cl2/c1-3-13-5-9-15(10-6-13)17(18(19)20)16-11-7-14(4-2)8-12-16/h5-12,17-18H,3-4H2,1-2H3 |