| Status: | BSI |
|---|---|
| IUPAC: | 5,6-dihydro-(1H,3H)-imidazo[2,1-c]-1,2,4-dithiazole-3-thione |
| CAS: | 5,6-dihydro-3H-imidazo[2,1-c]-1,2,4-dithiazole-3-thione |
| Reg. No.: | 33813-20-6 |
| Formula: | C4H4N2S3 |
| Activity: | fungicides (cyclic dithiocarbamate fungicides) |
| Notes: | There is no ISO common name for this substance; the name “etem” is approved by the British Standards Institution, and is also approved in China (代森硫). The name “ETM” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. Originally misidentified as hexahydro-1,3,6-thiadiazepine-2,7-dithione [5782-83-3]. |
| Structure: |  |
| Pronunciation: | ē-těm Guide to British pronunciation |
| InChIKey: | BFTGQIQVUVTBJU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C4H4N2S3/c7-4-6-2-1-5-3(6)8-9-4/h1-2H2 |