Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | S-ethyl dipropylcarbamothioate |
IUPAC name: | S-ethyl dipropylcarbamothioate 1979 Rules: S-ethyl dipropyl(thiocarbamate) |
CAS name: | S-ethyl N,N-dipropylcarbamothioate |
CAS Reg. No.: | 759-94-4 |
Formula: | C9H19NOS |
Activity: | herbicides (thiocarbamate) |
Notes: | |
Structure: | |
Pronunciation: | ē pē tē sē Guide to British pronunciation |
InChIKey: | GUVLYNGULCJVDO-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H19NOS/c1-4-7-10(8-5-2)9(11)12-6-3/h4-8H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names