| Status: |
JMAFF |
| IUPAC: |
4-ethylthiophenyl methylcarbamate |
| CAS: |
4-(ethylthio)phenyl N-methylcarbamate |
| Reg. No.: |
18809-57-9 |
| Formula: |
C10H13NO2S |
| Activity: |
insecticides (phenyl methylcarbamate insecticides) |
| Notes: |
There is no ISO common name for this substance; the name “EMPC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and is also approved in China (多杀威). |
| Structure: |
 |
| Pronunciation: |
ē ěm pē sē Guide to British pronunciation |
| InChIKey: |
OZJCQBUSEOVJOW-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C10H13NO2S/c1-3-14-9-6-4-8(5-7-9)13-10(12)11-2/h4-7H,3H2,1-2H3,(H,11,12) |