| Status: | none |
|---|---|
| IUPAC: | mixture of (S)-1-methylbutyl (E)-2,4-dimethylpent-2-enoate and (S)-1-methylbutyl (E)-2-methylpent-2-enoate |
| CAS: | (1S)-1-methylbutyl (2E)-2,4-dimethyl-2-pentenoate mixture with (1S)-1-methylbutyl (2E)-2-methyl-2-pentenoate |
| Reg. No.: | 80510-16-3 + 80510-15-2 |
| Formula: | C12H22O2 + C11H20O2 |
| Activity: | insect attractants (coleopteran attractants) |
| Notes: | There is no ISO common name for this substance; the name “dominicalure” has been used in the literature but has no official status. This substance is named after the insect from which it was isolated, Rhyzopertha dominica (Fabricius) (Bostrichidae, Coleoptera). |
| Structure: | ![]() |
| Pronunciation: | dǒ-mǐ-nē-ka-lūr Guide to British pronunciation |
| InChI: | (1S)-1-methylbutyl (2E)-2,4-dimethyl-2-pentenoate InChI=1/C12H22O2/c1-6-7-11(5)14-12(13)10(4)8-9(2)3/h8-9,11H,6-7H2,1-5H3/b10-8+/t11-/m0/s1 (1S)-1-methylbutyl (2E)-2-methyl-2-pentenoate InChI=1/C11H20O2/c1-5-7-9(3)11(12)13-10(4)8-6-2/h7,10H,5-6,8H2,1-4H3/b9-7+/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names