| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1-dodecylguanidinium acetate |
| CAS: | dodecylguanidine monoacetate |
| Reg. No.: | 2439-10-3 |
| Formula: | C15H33N3O2 |
| Activity: | fungicides (aliphatic nitrogen fungicides) |
| Notes: | The name “cytrex” (цитрекс) was used in the former USSR. The name “doguadine” is used in France. |
| Structure: | ![]() |
| Pronunciation: | dō-dēn Guide to British pronunciation |
| InChI: | InChI=1/C13H29N3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;1-2(3)4/h2-12H2,1H3,(H4,14,15,16);1H3,(H,3,4)/fC13H30N3.C2H3O2/h16H,14-15H2;/q+1;-1 |
A data sheet from the Compendium of Pesticide Common Names