| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1-dodecylguanidinium acetate |
| CAS: | dodecylguanidine monoacetate |
| Reg. No.: | 2439-10-3 |
| Formula: | C15H33N3O2 |
| Activity: | fungicides (aliphatic nitrogen fungicides) |
| Notes: | * According to ISO 1750, the name “doguadine” (n.f.) is used in France, but the ISO common name “dodine” (n.f.) also appears to be used. The name “cytrex” (цитрекс) was used in the former USSR. |
| Structure: |  |
| Pronunciation: | dō-dēn Guide to British pronunciation |
| InChI: | InChI=1/C13H29N3.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13(14)15;1-2(3)4/h2-12H2,1H3,(H4,14,15,16);1H3,(H,3,4)/fC13H30N3.C2H3O2/h16H,14-15H2;/q+1;-1 |