Status: | ISO 1750 (published) |
---|---|
IUPAC name: | N-(2-{[2-(dodecylamino)ethyl]amino}ethyl)glycine |
CAS name: | N-[2-[[2-(dodecylamino)ethyl]amino]ethyl]glycine |
CAS Reg. No.: | 6843-97-6 |
Formula: | C18H39N3O2 |
Activity: | bactericides fungicides (aliphatic nitrogen) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example dodicin hydrochloride [18205-85-1], dodicin-sodium [59079-49-1]. |
Structure: | |
Pronunciation: | dō-dǐ-sǐn Guide to British pronunciation |
InChIKey: | FSKNXCHJIFBRBT-UHFFFAOYSA-N |
InChI: | InChI=1S/C18H39N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-19-13-14-20-15-16-21-17-18(22)23/h19-21H,2-17H2,1H3,(H,22,23) |
A data sheet from the Compendium of Pesticide Common Names