| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4,6-dinitro-o-cresol |
| CAS: | 2-methyl-4,6-dinitrophenol |
| Reg. No.: | 534-52-1 |
| Formula: | C7H6N2O5 |
| Activity: | acaricides (dinitrophenol acaricides) fungicides (dinitrophenol fungicides) herbicides (dinitrophenol herbicides) insecticides (dinitrophenol insecticides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example DNOC-ammonium [2980-64-5], DNOC-potassium [5787-96-2], DNOC-sodium [2312-76-7]. |
| Structure: | ![]() |
| InChI: | InChI=1/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3 |
A data sheet from the Compendium of Pesticide Common Names