| Status: | ESA |
|---|---|
| IUPAC: | (7RS,8SR)-7,8-epoxy-2-methyloctadecane |
| CAS: | (2R,3S)-rel-2-decyl-3-(5-methylhexyl)oxirane |
| Reg. No.: | 29804-22-6 |
| Formula: | C19H38O |
| Activity: | insect attractants (lepidopteran attractants) mating disrupters |
| Notes: | There is no ISO common name for this substance; the name “disparlure” is approved by the Entomological Society of America. The active (+)-form is the (2S,3R)-isomer [54910-51-9]. This substance is named after the insect from which it was isolated, Lymantria dispar (Linnaeus) (Lymantriidae, Lepidoptera). |
| Structure: | ![]() |
| Pronunciation: | dǐs-par-lūr Guide to British pronunciation |
| InChI: | InChI=1/C19H38O/c1-4-5-6-7-8-9-10-11-15-18-19(20-18)16-13-12-14-17(2)3/h17-19H,4-16H2,1-3H3/t18-,19+/s3 |
A data sheet from the Compendium of Pesticide Common Names