| Status: | none |
|---|---|
| IUPAC: | diphenylamine |
| CAS: | N-phenylbenzenamine |
| Reg. No.: | 122-39-4 |
| Formula: | C12H11N |
| Activity: | fungicides (bridged diphenyl fungicides) |
| Notes: | There is no ISO common name for this substance; the name “diphenylamine” has been used in the literature but it has no official status. |
| Structure: | ![]() |
| Pronunciation: | dī-fē-nīl-a-mēn Guide to British pronunciation |
| InChIKey: | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
A data sheet from the Compendium of Pesticide Common Names