| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-cyclohexyl-4,6-dinitrophenol |
| CAS: | 2-cyclohexyl-4,6-dinitrophenol |
| Reg. No.: | 131-89-5 |
| Formula: | C12H14N2O5 |
| Activity: | acaricides (dinitrophenol acaricides) insecticides (dinitrophenol insecticides) |
| Notes: | * The name “pédinex” (n.m.) is used in France. When this substance is used as a salt, its identity should be stated, for example dinex-diclexine [317-83-9]. |
| Structure: | ![]() |
| Pronunciation: | dī-něks Guide to British pronunciation |
| InChIKey: | QJYHUJAGJUHXJN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H14N2O5/c15-12-10(8-4-2-1-3-5-8)6-9(13(16)17)7-11(12)14(18)19/h6-8,15H,1-5H2 |
A data sheet from the Compendium of Pesticide Common Names