| Status: | BSI |
|---|---|
| IUPAC: | 1-dimethylcarbamoyl-5-methylpyrazol-3-yl dimethylcarbamate |
| CAS: | 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl N,N-dimethylcarbamate |
| Reg. No.: | 644-64-4 |
| Formula: | C10H16N4O3 |
| Activity: | insecticides (dimethylcarbamate insecticides; pyrazole insecticides) |
| Notes: | There is no ISO common name for this substance; the name “dimetilan” is approved by the British Standards Institution, and is also approved in China (敌蝇威). |
| Structure: | ![]() |
| Pronunciation: | di-mět-ǐ-lǎn Guide to British pronunciation |
| InChIKey: | RDBIYWSVMRVKSG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H16N4O3/c1-7-6-8(17-10(16)13(4)5)11-14(7)9(15)12(2)3/h6H,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names