| Status: | ISO 765 |
|---|---|
| IUPAC: | dimethyl phthalate |
| CAS: | dimethyl 1,2-benzenedicarboxylate |
| Reg. No.: | 131-11-3 |
| Formula: | C10H10O4 |
| Activity: | insect repellents |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | dī-mēth-thīl fthǎl-āt Guide to British pronunciation |
| InChI: | InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names