| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 5-butyl-2-dimethylamino-6-methylpyrimidin-4-ol |
| CAS: | 5-butyl-2-(dimethylamino)-6-methyl-4(1H)-pyrimidinone |
| Reg. No.: | 5221-53-4 |
| Formula: | C11H19N3O |
| Activity: | fungicides (pyrimidine fungicides) |
| Notes: | The IUPAC name and the structural formula correspond to the information provided by the manufacturer. The CAS name and Registry Number are for the tautomer that is preferred under the CAS nomenclature rules. |
| Structure: |  |
| Pronunciation: | dī-mě-thǐr-ǐ-mǒl Guide to British pronunciation |
| InChI: | InChI=1/C11H19N3O/c1-5-6-7-9-8(2)12-11(14(3)4)13-10(9)15/h5-7H2,1-4H3,(H,12,13,15)/f/h15H CAS-preferred tautomer: InChI=1/C11H19N3O/c1-5-6-7-9-8(2)12-11(14(3)4)13-10(9)15/h5-7H2,1-4H3,(H,12,13,15)/f/h12H |