
French: diflumétorime (n.m.)Russian: дифлуметорим

Status: ISO 1750 (published)
IUPAC PIN: rac-5-chloro-N-{(1R)-1-[4-(difluoromethoxy)phenyl]propyl}-6-methylpyrimidin-4-amine
IUPAC name: (RS)-5-chloro-N-{1-[4-(difluoromethoxy)phenyl]propyl}-6-methylpyrimidin-4-ylamine
CAS name: 5-chloro-N-[1-[4-(difluoromethoxy)phenyl]propyl]-6-methyl-4-pyrimidinamine
CAS Reg. No.: 130339-07-0
Formula: C15H16ClF2N3O
Activity: fungicides (pyrimidine fungicides)
Structure: Structural formula of diflumetorim
Pronunciation: dī-floo--tō-rǐm  Guide to British pronunciation
InChI: InChI=1S/C15H16ClF2N3O/c1-3-12(21-14-13(16)9(2)19-8-20-14)10-4-6-11(7-5-10)22-15(17)18/h4-8,12,15H,3H2,1-2H3,(H,19,20,21)

A data sheet from the Compendium of Pesticide Common Names