| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
| CAS: | 3-(2-chlorophenyl)-6-(2,6-difluorophenyl)-1,2,4,5-tetrazine |
| Reg. No.: | 162320-67-4 |
| Formula: | C14H7ClF2N4 |
| Activity: | acaricides (mite growth regulators; tetrazine acaricides) |
| Notes: | The names “flufenzine” and “flutenzine” have been used in the literature, but they have no official status. |
| Structure: | ![]() |
| Pronunciation: | dī-flō-vǐd-a-zǐn Guide to British pronunciation |
| InChIKey: | SWBHWUYHHJCADA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H7ClF2N4/c15-9-5-2-1-4-8(9)13-18-20-14(21-19-13)12-10(16)6-3-7-11(12)17/h1-7H |
A data sheet from the Compendium of Pesticide Common Names