| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1,2-dimethyl-3,5-diphenylpyrazolium |
| CAS: | 1,2-dimethyl-3,5-diphenyl-1H-pyrazolium |
| Reg. No.: | 49866-87-7 |
| Formula: | C17H17N2 |
| Activity: | herbicides (pyrazole herbicides; quaternary ammonium herbicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example difenzoquat metilsulfate [43222-48-6]. |
| Structure: | ![]() |
| Pronunciation: | dī-fěn-zō-kwǒt Guide to British pronunciation |
| InChI: | InChI=1/C17H17N2/c1-18-16(14-9-5-3-6-10-14)13-17(19(18)2)15-11-7-4-8-12-15/h3-13H,1-2H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names