| Status: | BS 1831c |
|---|---|
| IUPAC: | N,N-diethyl-m-toluamide |
| CAS: | N,N-diethyl-3-methylbenzamide |
| Reg. No.: | 134-62-3 |
| Formula: | C12H17NO |
| Activity: | insect repellents |
| Notes: | This substance is considered by the British Standards Institution not to require a common name. The name “deet” is approved by the American National Standards Institute and the Entomological Society of America. |
| Structure: |  |
| Pronunciation: | dī-ē-thīl-tǒl-ū-a-mīd Guide to British pronunciation |
| InChIKey: | MMOXZBCLCQITDF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |