| Status: | none |
|---|---|
| IUPAC: | diethyl dicarbonate |
| CAS: | diethyl dicarbonate |
| Reg. No.: | 1609-47-8 |
| Formula: | C6H10O5 |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | There is no ISO common name for this substance; the name “diethyl pyrocarbonate” has been used in the literature but it has no official status. |
| Structure: |  |
| Pronunciation: | dī-ē-thǐl pīr-ō-kǎr-ban-āt Guide to British pronunciation |
| InChIKey: | FFYPMLJYZAEMQB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H10O5/c1-3-9-5(7)11-6(8)10-4-2/h3-4H2,1-2H3 |