| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 6-(3,5-dichloro-p-tolyl)pyridazin-3(2H)-one |
| CAS: | 6-(3,5-dichloro-4-methylphenyl)-3(2H)-pyridazinone |
| Reg. No.: | 62865-36-5 |
| Formula: | C11H8Cl2N2O |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example diclomezine-sodium [62902-57-2]. |
| Structure: | ![]() |
| Pronunciation: | dī-klō-mě-zēn Guide to British pronunciation |
| InChIKey: | UWQMKVBQKFHLCE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H8Cl2N2O/c1-6-8(12)4-7(5-9(6)13)10-2-3-11(16)15-14-10/h2-5H,1H3,(H,15,16) |
A data sheet from the Compendium of Pesticide Common Names