| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionic acid |
| CAS: | 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid |
| Reg. No.: | 40843-25-2 |
| Formula: | C15H12Cl2O4 |
| Activity: | herbicides (aryloxyphenoxypropionic herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example diclofop-methyl [51338-27-3]. |
| Structure: | ![]() |
| Pronunciation: | dī-clō-fǒp Guide to British pronunciation |
| InChI: | InChI=1/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19)/f/h18H |
A data sheet from the Compendium of Pesticide Common Names