| Status: | WSSA |
|---|---|
| IUPAC: | N,N-diallyl-2,2-dichloroacetamide |
| CAS: | 2,2-dichloro-N,N-di-2-propenylacetamide |
| Reg. No.: | 37764-25-3 |
| Formula: | C8H11Cl2NO |
| Activity: | herbicide safeners |
| Notes: | There is no ISO common name for this substance; the name “dichlormid” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-mǐd Guide to British pronunciation |
| InChI: | InChI=1/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h3-4,7H,1-2,5-6H2 |
A data sheet from the Compendium of Pesticide Common Names