Status: | China |
---|---|
IUPAC PIN: | 2,6-dichloro-N-[(4-chlorophenyl)carbamoyl]benzamide |
IUPAC name: | 2,6-dichloro-N-[(4-chlorophenyl)carbamoyl]benzamide 1979 Rules: 1-(4-chlorophenyl)-3-(2,6-dichlorobenzoyl)urea |
CAS name: | 2,6-dichloro-N-[[(4-chlorophenyl)amino]carbonyl]benzamide |
CAS Reg. No.: | 35409-97-3 |
Formula: | C14H9Cl3N2O2 |
Activity: | insecticides (benzoylurea) |
Notes: | There is no ISO common name for this substance; the name “dichlorbenzuron” (除幼脲) is approved in China. |
Structure: | |
Pronunciation: | dī-klor-běnz-ūr-ǒn Guide to British pronunciation |
InChIKey: | BTYQXKURSPAXLT-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H9Cl3N2O2/c15-8-4-6-9(7-5-8)18-14(21)19-13(20)12-10(16)2-1-3-11(12)17/h1-7H,(H2,18,19,20,21) |
A data sheet from the Compendium of Pesticide Common Names