| Status: | none |
|---|---|
| IUPAC PIN: | methyl 2-{4-[(2,4-dichlorophenyl)methyl]phenoxy}propanoate |
| IUPAC name: | methyl 2-[4-(2,4-dichlorobenzyl)phenoxy]propanoate 1979 Rules: methyl 2-[4-(2,4-dichlorobenzyl)phenoxy]propionate |
| CAS name: | methyl 2-[4-[(2,4-dichlorophenyl)methyl]phenoxy]propanoate |
| CAS Reg. No.: | |
| Formula: | C17H16Cl2O3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | There is no ISO common name for this substance; the name “dichlobenz-methyl” has been used in the literature but it has no official status. Diclobenz® is a registered trademark for products containing the nonsteroidal anti-inflammatory diclofenac. |
| Structure: |  |
| Pronunciation: | dī-klō-běnz mē-thīl Guide to British pronunciation |
| InChIKey: | QIWVGZJFXBPJAR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H16Cl2O3/c1-11(17(20)21-2)22-15-7-3-12(4-8-15)9-13-5-6-14(18)10-16(13)19/h3-8,10-11H,9H2,1-2H3 |