Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | N2-methyl-6-(methylsulfanyl)-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
IUPAC name: | N2-isopropyl-N4-methyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS name: | N2-methyl-N4-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 1014-69-3 |
Formula: | C8H15N5S |
Activity: | herbicides (alkylthiotriazine) |
Notes: | The name “desmetryne” was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | děz-mě-trǐn Guide to British pronunciation |
InChIKey: | HCRWJJJUKUVORR-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H15N5S/c1-5(2)10-7-11-6(9-3)12-8(13-7)14-4/h5H,1-4H3,(H2,9,10,11,12,13) |
A data sheet from the Compendium of Pesticide Common Names