| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium 2-oxo-3-[(RS)-3-oxo-1-phenylbutyl]-2H-chromen-4-olate |
| CAS: | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one potassium salt |
| Reg. No.: | 2610-86-8 |
| Formula: | C19H15KO4 |
| Activity: | rodenticides (coumarin rodenticides) |
| Notes: | This substance is a derivative of warfarin [81-81-2]. The name “coumafène-potassium” is used in France. The name “zoocoumarin-potassium” was used in the former USSR. |
| Structure: |  |
| Pronunciation: | wor-fa-rǐn pa-tǎs-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C19H16O4.K/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;/h2-10,15,21H,11H2,1H3;/q;+1/p-1/fC19H15O4.K/h21h;/q-1;m |