| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | ethyl (RS)-4-cyclopropyl(hydroxy)methylene-3,5-dioxocyclohexanecarboxylate |
| CAS: | ethyl 4-(cyclopropylhydroxymethylene)-3,5-dioxocyclohexanecarboxylate |
| Reg. No.: | 95266-40-3 |
| Formula: | C13H16O5 |
| Activity: | plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of trinexapac [104273-73-6]. The name “抗倒酯” is approved in China for trinexapac and for trinexapac-ethyl. |
| Structure: |  |
| Pronunciation: | trī-něks-a-pǎk ē-thīl Guide to British pronunciation |
| InChIKey: | RVKCCVTVZORVGD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H16O5/c1-2-18-13(17)8-5-9(14)11(10(15)6-8)12(16)7-3-4-7/h7-8,16H,2-6H2,1H3 |