Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | ethyl {2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy}acetate |
IUPAC name: | ethyl {2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy}acetate |
CAS name: | ethyl 2-[2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy]acetate |
CAS Reg. No.: | 129630-19-9 |
Formula: | C15H13Cl2F3N2O4 |
Activity: | herbicides (phenylpyrazole) |
Notes: | This substance is a derivative of pyraflufen [129630-17-7]. |
Structure: | |
Pronunciation: | pīr-a-floo-fěn ē-thīl Guide to British pronunciation |
InChIKey: | APTZNLHMIGJTEW-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H13Cl2F3N2O4/c1-3-24-11(23)6-25-10-4-7(9(18)5-8(10)16)13-12(17)14(22(2)21-13)26-15(19)20/h4-5,15H,3,6H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names