| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium O-isopropyl dithiocarbonate |
| CAS: | sodium O-(1-methylethyl) carbonodithioate |
| Reg. No.: | 140-93-2 |
| Formula: | C4H7NaOS2 |
| Activity: | herbicides (thiocarbonate herbicides) |
| Notes: | This substance is a derivative of proxan [108-25-8]. The name “proxan-sodium” was formerly approved by ISO for the sodium salt, but this was replaced by the name “proxan” for the monoisopropyl ester as part of a rationalisation exercise in 1989. |
| Structure: |  |
| Pronunciation: | prǒks-ǎn sō-dē-am Guide to British pronunciation |
| InChIKey: | IRZFQKXEKAODTJ-UHFFFAOYSA-M |
| InChI: | InChI=1S/C4H8OS2.Na/c1-3(2)5-4(6)7;/h3H,1-2H3,(H,6,7);/q;+1/p-1 |