Status: | modified ISO 765 |
---|---|
IUPAC PIN: | potassium (naphthalen-1-yl)acetate |
IUPAC name: | potassium 1-naphthylacetate |
CAS name: | potassium 1-naphthaleneacetate |
CAS Reg. No.: | 15165-79-4 |
Formula: | C12H9KO2 |
Activity: | plant growth regulators (auxin) |
Notes: | This substance is a derivative of 1-naphthaleneacetic acid [86-87-3]. |
Structure: | |
Pronunciation: | pa-tǎs-ē-am wǔn nǎf-tha-lēn-ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | HPQBUYIHTJNBOM-UHFFFAOYSA-M |
InChI: | InChI=1S/C12H10O2.K/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names