Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) |
IUPAC name: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - 2,2′,2″-nitrilotriethanol (1:1) or 4-amino-3,5,6-trichloropicolinic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate or tris(2-hydroxyethyl)ammonium 4-amino-3,5,6-trichloropicolinate |
CAS name: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
CAS Reg. No.: | 82683-78-1 |
Formula: | C12H18Cl3N3O5 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | This substance is a derivative of picloram [1918-02-1]. |
Structure: | |
Pronunciation: | pǐ-klor-ǎm trǒl-a-mēn Guide to British pronunciation |
InChIKey: | KLSSIPFIAURKSX-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H3Cl3N2O2.C6H15NO3/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;8-4-1-7(2-5-9)3-6-10/h(H2,10,11)(H,12,13);8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names