| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - (2RS,2′RS,2″RS)-1,1′,1″-nitrilotripropan-2-ol (1:1) or (2RS,2′RS,2″RS)-tris(2-hydroxypropyl)ammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate or 4-amino-3,5,6-trichloropicolinic acid - (2RS,2′RS,2″RS)-1,1′,1″-nitrilotripropan-2-ol (1:1) or (2RS,2′RS,2″RS)-tris(2-hydroxypropyl)ammonium 4-amino-3,5,6-trichloropicolinate |
| CAS: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with 1,1′,1″-nitrilotris[2-propanol] (1:1) |
| Reg. No.: | 6753-47-5 |
| Formula: | C15H24Cl3N3O5 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. |
| Structure: | ![]() |
| InChI: | InChI=1/C9H21NO3.C6H3Cl3N2O2/c1-7(11)4-10(5-8(2)12)6-9(3)13;7-1-3(10)2(8)5(9)11-4(1)6(12)13/h7-9,11-13H,4-6H2,1-3H3;(H2,10,11)(H,12,13)/t7-,8-,9+;/s3/f/h;12H,10H2 |
A data sheet from the Compendium of Pesticide Common Names