Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid—N,N-diethylethan-1-amine (1/1) |
IUPAC name: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - triethylamine (1:1) or 4-amino-3,5,6-trichloropicolinic acid - triethylamine (1:1) or triethylammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate or triethylammonium 4-amino-3,5,6-trichloropicolinate |
CAS name: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with N,N-diethylethanamine (1:1) |
CAS Reg. No.: | 35832-11-2 |
Formula: | C12H19Cl3N3O2 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | This substance is a derivative of picloram [1918-02-1]. |
Structure: | |
Pronunciation: | pǐ-klor-ǎm trī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | WFMULRZXIUQYFV-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H3Cl3N2O2.C6H15N/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;1-4-7(5-2)6-3/h(H2,10,11)(H,12,13);4-6H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names