| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - triethylamine (1:1) or 4-amino-3,5,6-trichloropicolinic acid - triethylamine (1:1) or triethylammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate or triethylammonium 4-amino-3,5,6-trichloropicolinate |
| CAS: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with N,N-diethylethanamine (1:1) |
| Reg. No.: | 35832-11-2 |
| Formula: | C12H19Cl3N3O2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. |
| Structure: | ![]() |
| InChI: | InChI=1/C6H3Cl3N2O2.C6H15N/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;1-4-7(5-2)6-3/h(H2,10,11)(H,12,13);4-6H2,1-3H3/f/h12H,10H2; |
A data sheet from the Compendium of Pesticide Common Names