| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium 4-amino-3,5,6-trichloropyridine-2-carboxylate or potassium 4-amino-3,5,6-trichloropicolinate |
| CAS: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid monopotassium salt |
| Reg. No.: | 2545-60-0 |
| Formula: | C6H2Cl3KN2O2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. |
| Structure: | ![]() |
| Pronunciation: | pǐ-klor-ǎm pa-tǎs-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C6H3Cl3N2O2.K/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;/h(H2,10,11)(H,12,13);/q;+1/p-1/fC6H2Cl3N2O2.K/h10H2;/q-1;m |
A data sheet from the Compendium of Pesticide Common Names