| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl 4-amino-3,5,6-trichloropyridine-2-carboxylate or methyl 4-amino-3,5,6-trichloropicolinate |
| CAS: | methyl 4-amino-3,5,6-trichloro-2-pyridinecarboxylate |
| Reg. No.: | 14143-55-6 |
| Formula: | C7H5Cl3N2O2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. |
| Structure: | ![]() |
| Pronunciation: | pǐ-klor-ǎm mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C7H5Cl3N2O2/c1-14-7(13)5-2(8)4(11)3(9)6(10)12-5/h1H3,(H2,11,12)/f/h11H2 |
A data sheet from the Compendium of Pesticide Common Names