Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid—N-methylmethanamine (1/1) |
IUPAC name: | 4-amino-3,5,6-trichloropyridine-2-carboxylic acid - dimethylamine (1:1) or 4-amino-3,5,6-trichloropicolinic acid - dimethylamine (1:1) or dimethylammonium 4-amino-3,5,6-trichloropyridine-2-carboxylate or dimethylammonium 4-amino-3,5,6-trichloropicolinate |
CAS name: | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with N-methylmethanamine (1:1) |
CAS Reg. No.: | 55870-98-9 |
Formula: | C8H10Cl3N3O2 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | This substance is a derivative of picloram [1918-02-1]. |
Structure: | |
Pronunciation: | pǐ-klor-ǎm dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | NPLPNFIMSLUIMN-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H3Cl3N2O2.C2H7N/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;1-3-2/h(H2,10,11)(H,12,13);3H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names