| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate or (RS)-2-ethylhexyl 4-amino-3,5,6-trichloropicolinate |
| CAS: | 2-ethylhexyl 4-amino-3,5,6-trichloro-2-pyridinecarboxylate |
| Reg. No.: | 36374-99-9 |
| Formula: | C14H19Cl3N2O2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. |
| Structure: | ![]() |
| Pronunciation: | pǐ-klor-ǎm too ē-thīl-hěks-īl Guide to British pronunciation |
| InChI: | InChI=1/C14H19Cl3N2O2/c1-3-5-6-8(4-2)7-21-14(20)12-9(15)11(18)10(16)13(17)19-12/h8H,3-7H2,1-2H3,(H2,18,19)/t8-/s3/f/h18H2 |
A data sheet from the Compendium of Pesticide Common Names