| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 5-bromo-1,6-dihydro-6-oxo-1-phenylpyridazin-4-yloxamate |
| CAS: | [(5-bromo-1,6-dihydro-6-oxo-1-phenyl-4-pyridazinyl)amino]oxoacetic acid monosodium salt |
| Reg. No.: | 25316-56-7 |
| Formula: | C12H7BrN3NaO4 |
| Activity: | herbicides (pyridazinone herbicides) |
| Notes: | This substance is a derivative of oxapyrazon [4489-31-0]. The name “oxapyrazone-sodium” was formerly approved by the British Standards Institution. The names “oxapyrazon” and “oxapyrazon-sodium” were both formerly approved by ISO, but “oxapyrazon-sodium” was deleted as part of a rationalisation exercise in 1989. |
| Structure: | ![]() |
| InChI: | InChI=1/C12H8BrN3O4.Na/c13-9-8(15-10(17)12(19)20)6-14-16(11(9)18)7-4-2-1-3-5-7;/h1-6H,(H,15,17)(H,19,20);/q;+1/p-1/fC12H7BrN3O4.Na/h15H;/q-1;m |
A data sheet from the Compendium of Pesticide Common Names