Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) |
IUPAC name: | (RS)-2-[(4-chloro-o-tolyl)oxy]propionic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium (RS)-2-[(4-chloro-o-tolyl)oxy]propionate |
CAS name: | 2-(4-chloro-2-methylphenoxy)propanoic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
CAS Reg. No.: | 53404-61-8 |
Formula: | C16H26ClNO6 |
Activity: | herbicides (phenoxypropionic) |
Notes: | This substance is a derivative of mecoprop [93-65-2]. |
Structure: | |
Pronunciation: | měk-o-prǒp trǒl-a-mēn Guide to British pronunciation |
InChIKey: | UWFHYRNEUYQQMI-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H13ClO3.C6H15NO3/c1-7-6-9(12)4-5-10(7)15-8(2)11(13)14-3;8-4-1-7(2-5-9)3-6-10/h4-6,8H,1-3H3;8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names