| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-(4-chloro-o-tolyloxy)propionic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | 2-(4-chloro-2-methylphenoxy)propanoic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
| Reg. No.: | 53404-61-8 |
| Formula: | C16H26ClNO6 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop [7085-19-0]. |
| Structure: | ![]() |
| Pronunciation: | měk-o-prǒp trǒl-a-mēn Guide to British pronunciation |
| InChIKey: | UWFHYRNEUYQQMI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H13ClO3.C6H15NO3/c1-7-6-9(12)4-5-10(7)15-8(2)11(13)14-3;8-4-1-7(2-5-9)3-6-10/h4-6,8H,1-3H3;8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names