| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | potassium 2-(4-chloro-2-methylphenoxy)propanoate |
| Reg. No.: | 1929-86-8 |
| Formula: | C10H10ClKO3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop [7085-19-0]. The name “MCPP-potassium” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. The (R)-isomer of this substance has the ISO common name mecoprop-P-potassium. |
| Structure: | ![]() |
| Pronunciation: | měk-o-prǒp pa-tǎs-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C10H11ClO3.K/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;/h3-5,7H,1-2H3,(H,12,13);/q;+1/p-1/fC10H10ClO3.K/q-1;m-potassium |
A data sheet from the Compendium of Pesticide Common Names