| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl (RS)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | methyl 2-(4-chloro-2-methylphenoxy)propanoate |
| Reg. No.: | 2786-19-8 |
| Formula: | C11H13ClO3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop [7085-19-0]. The name “MCPP-methyl” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | měk-o-prǒp mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C11H13ClO3/c1-7-6-9(12)4-5-10(7)15-8(2)11(13)14-3/h4-6,8H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names