| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-(4-chloro-o-tolyloxy)propionic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | 2-(4-chloro-2-methylphenoxy)propanoic acid compound with 2,2′-iminobis[ethanol] (1:1) |
| Reg. No.: | 1432-14-0 |
| Formula: | C14H22ClNO5 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop [7085-19-0]. |
| Structure: | ![]() |
| Pronunciation: | měk-o-prǒp dī-ǒl-a-mēn Guide to British pronunciation |
| InChIKey: | CGFQAAGKJZMVNF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H11ClO3.C4H11NO2/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;6-3-1-5-2-4-7/h3-5,7H,1-2H3,(H,12,13);5-7H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names