| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-ethylhexyl (RS)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | 2-ethylhexyl 2-(4-chloro-2-methylphenoxy)propanoate |
| Reg. No.: | 71526-69-7 |
| Formula: | C18H27ClO3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop [7085-19-0]. The (R)-isomer of this substance has the ISO common name mecoprop-P-2-ethylhexyl [861229-15-4]. |
| Structure: | ![]() |
| Pronunciation: | měk-o-prǒp too ē-thīl-hěks-īl Guide to British pronunciation |
| InChIKey: | NWTKQOOQEPXMMW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H27ClO3/c1-5-7-8-15(6-2)12-21-18(20)14(4)22-17-10-9-16(19)11-13(17)3/h9-11,14-15H,5-8,12H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names